C45H44N2O12 — CID 118216302
methyl 2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-5-[(E)-[(E)-[4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate (PubChem CID 118216302) has the molecular formula C45H44N2O12 and a molecular weight of 804.85 g/mol. Its IUPAC name is methyl 2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-5-[(E)-[(E)-[4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate.
| Compound Name | methyl 2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-5-[(E)-[(E)-[4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 118216302 |
| Molecular Formula | C45H44N2O12 |
| Molecular Weight | 804.85 g/mol |
| Exact Mass | 804.29 |
| IUPAC Name | methyl 2-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxy-5-[(E)-[(E)-[4-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/N=C/c3ccc(OC(=O)c4ccc(OCCCCOC(=O)C=C)cc4)c(C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C45H44N2O12/c1-4-41(48)56-27-8-6-7-25-54-36-20-14-34(15-21-36)43(50)58-38-18-11-32(12-19-38)30-46-47-31-33-13-24-40(39(29-33)45(52)53-3)59-44(51)35-16-22-37(23-17-35)55-26-9-10-28-57-42(49)5-2/h4-5,11-24,29-31H,1-2,6-10,25-28H2,3H3/b46-30+,47-31+ |
| InChIKey | LOAQSZLXZDBMNI-DWBUZRECSA-N |
| XLogP | 7.53 |
| TPSA | 174.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.85 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|