C48H52N2O11 — CID 165153121
[4-[(E)-[(E)-[3-acetyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]methylidenehydrazinylidene]methyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 165153121) has the molecular formula C48H52N2O11 and a molecular weight of 832.95 g/mol. Its IUPAC name is [4-[(E)-[(E)-[3-acetyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]methylidenehydrazinylidene]methyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[(E)-[(E)-[3-acetyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]methylidenehydrazinylidene]methyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 165153121 |
| Molecular Formula | C48H52N2O11 |
| Molecular Weight | 832.95 g/mol |
| Exact Mass | 832.36 |
| IUPAC Name | [4-[(E)-[(E)-[3-acetyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]methylidenehydrazinylidene]methyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OCOc2ccc(/C=N/N=C/c3ccc(OC(=O)c4ccc(OCCCCCCOC(=O)C=C)cc4)cc3)cc2C(C)=O)cc1 |
| InChI | InChI=1S/C48H52N2O11/c1-4-46(52)57-30-12-8-6-10-28-55-40-21-17-39(18-22-40)48(54)61-43-19-14-37(15-20-43)33-49-50-34-38-16-27-45(44(32-38)36(3)51)60-35-59-42-25-23-41(24-26-42)56-29-11-7-9-13-31-58-47(53)5-2/h4-5,14-27,32-34H,1-2,6-13,28-31,35H2,3H3/b49-33+,50-34+ |
| InChIKey | NBGAFCNSZKWOOX-KWAQGTMGSA-N |
| XLogP | 9.31 |
| TPSA | 157.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.95 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|