C48H50N2O12 — CID 102136377
methyl 2-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-5-[(Z)-[(Z)-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate (PubChem CID 102136377) has the molecular formula C48H50N2O12 and a molecular weight of 846.93 g/mol. Its IUPAC name is methyl 2-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-5-[(Z)-[(Z)-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate.
| Compound Name | methyl 2-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-5-[(Z)-[(Z)-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 102136377 |
| Molecular Formula | C48H50N2O12 |
| Molecular Weight | 846.93 g/mol |
| Exact Mass | 846.34 |
| IUPAC Name | methyl 2-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-5-[(Z)-[(Z)-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]methylidenehydrazinylidene]methyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N\N=C/c3ccc(OC(=O)c4ccc(OCCCCCCOC(=O)C=C)cc4)c(C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C48H50N2O12/c1-4-44(51)59-30-12-8-6-10-28-57-39-23-17-37(18-24-39)46(53)61-41-21-14-35(15-22-41)33-49-50-34-36-16-27-43(42(32-36)48(55)56-3)62-47(54)38-19-25-40(26-20-38)58-29-11-7-9-13-31-60-45(52)5-2/h4-5,14-27,32-34H,1-2,6-13,28-31H2,3H3/b49-33-,50-34- |
| InChIKey | LXPIEQAYSCLMGS-DFIRVOSISA-N |
| XLogP | 8.70 |
| TPSA | 174.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.93 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|