C26H26O5 — CID 90050408
(2,4-dimethylphenyl) 6-(4-prop-2-enoyloxybutoxy)naphthalene-2-carboxylate (PubChem CID 90050408) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 6-(4-prop-2-enoyloxybutoxy)naphthalene-2-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 6-(4-prop-2-enoyloxybutoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90050408 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (2,4-dimethylphenyl) 6-(4-prop-2-enoyloxybutoxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCOc1ccc2cc(C(=O)Oc3ccc(C)cc3C)ccc2c1 |
| InChI | InChI=1S/C26H26O5/c1-4-25(27)30-14-6-5-13-29-23-11-10-20-16-22(9-8-21(20)17-23)26(28)31-24-12-7-18(2)15-19(24)3/h4,7-12,15-17H,1,5-6,13-14H2,2-3H3 |
| InChIKey | VELIEMSXXYFXDZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|