C19H18O5 — CID 126651896
(2,4-dimethylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate (PubChem CID 126651896) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate.
| Compound Name | (2,4-dimethylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 126651896 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2,4-dimethylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate |
| SMILES | C=CC(=O)OCOc1ccc(C(=O)Oc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H18O5/c1-4-18(20)23-12-22-16-8-6-15(7-9-16)19(21)24-17-10-5-13(2)11-14(17)3/h4-11H,1,12H2,2-3H3 |
| InChIKey | WLGBEISGXKIING-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|