C34H34O12 — CID 137454184
[2-methyl-4-[4-(2-prop-2-enoyloxyethoxymethoxy)benzoyl]oxyphenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoate (PubChem CID 137454184) has the molecular formula C34H34O12 and a molecular weight of 634.63 g/mol. Its IUPAC name is [2-methyl-4-[4-(2-prop-2-enoyloxyethoxymethoxy)benzoyl]oxyphenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoate.
| Compound Name | [2-methyl-4-[4-(2-prop-2-enoyloxyethoxymethoxy)benzoyl]oxyphenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 137454184 |
| Molecular Formula | C34H34O12 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | [2-methyl-4-[4-(2-prop-2-enoyloxyethoxymethoxy)benzoyl]oxyphenyl] 4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoate |
| SMILES | C=CC(=O)OCCOCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCOCCOC(=O)C=C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C34H34O12/c1-4-31(35)42-20-17-39-16-19-41-27-10-6-26(7-11-27)34(38)46-30-15-14-29(22-24(30)3)45-33(37)25-8-12-28(13-9-25)44-23-40-18-21-43-32(36)5-2/h4-15,22H,1-2,16-21,23H2,3H3 |
| InChIKey | GLPGEUBWRLYAQE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|