C34H30O7 — CID 118880201
[2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-phenylbenzoate (PubChem CID 118880201) has the molecular formula C34H30O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-phenylbenzoate.
| Compound Name | [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 118880201 |
| Molecular Formula | C34H30O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [2-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-phenylbenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(-c4ccccc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C34H30O7/c1-3-32(35)39-22-8-7-21-38-29-17-15-28(16-18-29)33(36)40-30-19-20-31(24(2)23-30)41-34(37)27-13-11-26(12-14-27)25-9-5-4-6-10-25/h3-6,9-20,23H,1,7-8,21-22H2,2H3 |
| InChIKey | CIJKWCHSEIHPQI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|