C35H36O11 — CID 137394835
[3-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoylperoxybutoxy)benzoate (PubChem CID 137394835) has the molecular formula C35H36O11 and a molecular weight of 632.66 g/mol. Its IUPAC name is [3-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoylperoxybutoxy)benzoate.
| Compound Name | [3-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoylperoxybutoxy)benzoate |
|---|---|
| PubChem CID | 137394835 |
| Molecular Formula | C35H36O11 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | [3-methyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoylperoxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCOOC(=O)C=C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C35H36O11/c1-4-32(36)42-22-7-6-20-40-29-16-12-27(13-17-29)35(39)45-31-19-18-30(24-25(31)3)44-34(38)26-10-14-28(15-11-26)41-21-8-9-23-43-46-33(37)5-2/h4-5,10-19,24H,1-2,6-9,20-23H2,3H3 |
| InChIKey | PXSDMNBZVOYXLX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|