C19H16O7 — CID 54225786
(4-methoxycarbonylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate (PubChem CID 54225786) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate.
| Compound Name | (4-methoxycarbonylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 54225786 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (4-methoxycarbonylphenyl) 4-(prop-2-enoyloxymethoxy)benzoate |
| SMILES | C=CC(=O)OCOc1ccc(C(=O)Oc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C19H16O7/c1-3-17(20)25-12-24-15-8-4-14(5-9-15)19(22)26-16-10-6-13(7-11-16)18(21)23-2/h3-11H,1,12H2,2H3 |
| InChIKey | QFTOCZGLHSXVMR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|