C24H19BO9 — CID 159313804
[4-[4-[4-(prop-2-enoyloxymethoxy)benzoyl]oxyphenoxy]carbonylphenyl]boronic acid (PubChem CID 159313804) has the molecular formula C24H19BO9 and a molecular weight of 462.22 g/mol. Its IUPAC name is [4-[4-[4-(prop-2-enoyloxymethoxy)benzoyl]oxyphenoxy]carbonylphenyl]boronic acid.
| Compound Name | [4-[4-[4-(prop-2-enoyloxymethoxy)benzoyl]oxyphenoxy]carbonylphenyl]boronic acid |
|---|---|
| PubChem CID | 159313804 |
| Molecular Formula | C24H19BO9 |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [4-[4-[4-(prop-2-enoyloxymethoxy)benzoyl]oxyphenoxy]carbonylphenyl]boronic acid |
| SMILES | C=CC(=O)OCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(B(O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H19BO9/c1-2-22(26)32-15-31-19-9-5-17(6-10-19)24(28)34-21-13-11-20(12-14-21)33-23(27)16-3-7-18(8-4-16)25(29)30/h2-14,29-30H,1,15H2 |
| InChIKey | NOTRYRKYNZCSHV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|