C36H33BO11 — CID 140945661
[4-[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylbenzoyl]oxyphenyl]boronic acid (PubChem CID 140945661) has the molecular formula C36H33BO11 and a molecular weight of 652.46 g/mol. Its IUPAC name is [4-[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylbenzoyl]oxyphenyl]boronic acid.
| Compound Name | [4-[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylbenzoyl]oxyphenyl]boronic acid |
|---|---|
| PubChem CID | 140945661 |
| Molecular Formula | C36H33BO11 |
| Molecular Weight | 652.46 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | [4-[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylbenzoyl]oxyphenyl]boronic acid |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(C(=O)Oc4ccc(B(O)O)cc4)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C36H33BO11/c1-4-33(38)45-22-6-5-21-44-29-15-11-27(12-16-29)36(41)48-32-20-19-31(23(2)24(32)3)47-35(40)26-9-7-25(8-10-26)34(39)46-30-17-13-28(14-18-30)37(42)43/h4,7-20,42-43H,1,5-6,21-22H2,2-3H3 |
| InChIKey | YSDSNLZIEQRCIL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|