C38H42O10 — CID 134352408
[3-tert-butyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 134352408) has the molecular formula C38H42O10 and a molecular weight of 658.74 g/mol. Its IUPAC name is [3-tert-butyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [3-tert-butyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 134352408 |
| Molecular Formula | C38H42O10 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | [3-tert-butyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCOC(=O)C=C)cc3)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C38H42O10/c1-6-34(39)45-24-10-8-22-43-29-16-12-27(13-17-29)36(41)47-31-20-21-33(32(26-31)38(3,4)5)48-37(42)28-14-18-30(19-15-28)44-23-9-11-25-46-35(40)7-2/h6-7,12-21,26H,1-2,8-11,22-25H2,3-5H3 |
| InChIKey | MBNPUAINQHSADI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|