C38H41BO10 — CID 144925495
[4-[[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid;ethane (PubChem CID 144925495) has the molecular formula C38H41BO10 and a molecular weight of 668.55 g/mol. Its IUPAC name is [4-[[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid;ethane.
| Compound Name | [4-[[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid;ethane |
|---|---|
| PubChem CID | 144925495 |
| Molecular Formula | C38H41BO10 |
| Molecular Weight | 668.55 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | [4-[[4-[2,3-dimethyl-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid;ethane |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCc4ccc(B(O)O)cc4)cc3)c(C)c2C)cc1.CC |
| InChI | InChI=1S/C36H35BO10.C2H6/c1-4-34(38)44-22-6-5-21-43-30-15-9-27(10-16-30)35(39)46-32-19-20-33(25(3)24(32)2)47-36(40)28-11-17-31(18-12-28)45-23-26-7-13-29(14-8-26)37(41)42;1-2/h4,7-20,41-42H,1,5-6,21-23H2,2-3H3;1-2H3 |
| InChIKey | PCYXTGAGQWZNSC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|