C37H41BO8 — CID 140912356
[4-[[4-[2,3-dimethyl-4-(4-octoxybenzoyl)oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid (PubChem CID 140912356) has the molecular formula C37H41BO8 and a molecular weight of 624.54 g/mol. Its IUPAC name is [4-[[4-[2,3-dimethyl-4-(4-octoxybenzoyl)oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[2,3-dimethyl-4-(4-octoxybenzoyl)oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140912356 |
| Molecular Formula | C37H41BO8 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [4-[[4-[2,3-dimethyl-4-(4-octoxybenzoyl)oxyphenoxy]carbonylphenoxy]methyl]phenyl]boronic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCc4ccc(B(O)O)cc4)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C37H41BO8/c1-4-5-6-7-8-9-24-43-32-18-12-29(13-19-32)36(39)45-34-22-23-35(27(3)26(34)2)46-37(40)30-14-20-33(21-15-30)44-25-28-10-16-31(17-11-28)38(41)42/h10-23,41-42H,4-9,24-25H2,1-3H3 |
| InChIKey | FPOVHPPWVDXMQW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|