C39H45BO10 — CID 144989919
[4-[[4-[(2E,4Z)-4,5-dimethyl-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-3-yl]oxycarbonylphenoxy]methyl]phenyl]boronic acid;ethane (PubChem CID 144989919) has the molecular formula C39H45BO10 and a molecular weight of 684.59 g/mol. Its IUPAC name is [4-[[4-[(2E,4Z)-4,5-dimethyl-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-3-yl]oxycarbonylphenoxy]methyl]phenyl]boronic acid;ethane.
| Compound Name | [4-[[4-[(2E,4Z)-4,5-dimethyl-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-3-yl]oxycarbonylphenoxy]methyl]phenyl]boronic acid;ethane |
|---|---|
| PubChem CID | 144989919 |
| Molecular Formula | C39H45BO10 |
| Molecular Weight | 684.59 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | [4-[[4-[(2E,4Z)-4,5-dimethyl-6-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyhepta-2,4,6-trien-3-yl]oxycarbonylphenoxy]methyl]phenyl]boronic acid;ethane |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)OC(=C)/C(C)=C(C)\C(=C/C)OC(=O)c2ccc(OCc3ccc(B(O)O)cc3)cc2)cc1.CC |
| InChI | InChI=1S/C37H39BO10.C2H6/c1-6-34(48-37(41)30-14-20-33(21-15-30)46-24-28-10-16-31(17-11-28)38(42)43)26(4)25(3)27(5)47-36(40)29-12-18-32(19-13-29)44-22-8-9-23-45-35(39)7-2;1-2/h6-7,10-21,42-43H,2,5,8-9,22-24H2,1,3-4H3;1-2H3/b26-25-,34-6+; |
| InChIKey | ZFODTVXBCUZIEF-JBZGTRJNSA-N |
| XLogP | 6.63 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|