C29H28O6 — CID 174791572
[4-(6-prop-2-enoyloxyhexoxy)benzoyl] 4-phenylbenzoate (PubChem CID 174791572) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)benzoyl] 4-phenylbenzoate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)benzoyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 174791572 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)benzoyl] 4-phenylbenzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)OC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H28O6/c1-2-27(30)34-21-9-4-3-8-20-33-26-18-16-25(17-19-26)29(32)35-28(31)24-14-12-23(13-15-24)22-10-6-5-7-11-22/h2,5-7,10-19H,1,3-4,8-9,20-21H2 |
| InChIKey | GISQPSMKWOSVJZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|