C20H28O5 — CID 18942550
4-(10-prop-2-enoyloxydecoxy)benzoic acid (PubChem CID 18942550) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 4-(10-prop-2-enoyloxydecoxy)benzoic acid.
| Compound Name | 4-(10-prop-2-enoyloxydecoxy)benzoic acid |
|---|---|
| PubChem CID | 18942550 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-(10-prop-2-enoyloxydecoxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCCCCCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H28O5/c1-2-19(21)25-16-10-8-6-4-3-5-7-9-15-24-18-13-11-17(12-14-18)20(22)23/h2,11-14H,1,3-10,15-16H2,(H,22,23) |
| InChIKey | BYHJFJWELPBFAI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|