C22H27NO6 — CID 70364014
4-methoxyaniline;4-(5-prop-2-enoyloxypentoxy)benzoic acid (PubChem CID 70364014) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-methoxyaniline;4-(5-prop-2-enoyloxypentoxy)benzoic acid.
| Compound Name | 4-methoxyaniline;4-(5-prop-2-enoyloxypentoxy)benzoic acid |
|---|---|
| PubChem CID | 70364014 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-methoxyaniline;4-(5-prop-2-enoyloxypentoxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C(=O)O)cc1.COc1ccc(N)cc1 |
| InChI | InChI=1S/C15H18O5.C7H9NO/c1-2-14(16)20-11-5-3-4-10-19-13-8-6-12(7-9-13)15(17)18;1-9-7-4-2-6(8)3-5-7/h2,6-9H,1,3-5,10-11H2,(H,17,18);2-5H,8H2,1H3 |
| InChIKey | IHFYPENGEUNEFL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|