C29H34N2O3 — CID 118554210
6-[4-[2,2-bis(4-aminophenyl)ethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 118554210) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 6-[4-[2,2-bis(4-aminophenyl)ethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2,2-bis(4-aminophenyl)ethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 118554210 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 6-[4-[2,2-bis(4-aminophenyl)ethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CC(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O3/c1-2-29(32)34-20-6-4-3-5-19-33-27-17-7-22(8-18-27)21-28(23-9-13-25(30)14-10-23)24-11-15-26(31)16-12-24/h2,7-18,28H,1,3-6,19-21,30-31H2 |
| InChIKey | GDCIPZHPJKJAHA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|