C23H27NO6 — CID 88609531
(4-methoxyanilino) 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 88609531) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (4-methoxyanilino) 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | (4-methoxyanilino) 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 88609531 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (4-methoxyanilino) 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)ONc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-3-22(25)29-17-7-5-4-6-16-28-21-12-8-18(9-13-21)23(26)30-24-19-10-14-20(27-2)15-11-19/h3,8-15,24H,1,4-7,16-17H2,2H3 |
| InChIKey | GPEZUOCXGWJTFQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|