C25H30N2O5 — CID 20615391
methyl 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate (PubChem CID 20615391) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is methyl 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate.
| Compound Name | methyl 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 20615391 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | methyl 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O5/c1-3-24(28)32-19-9-7-5-4-6-8-18-31-23-16-14-22(15-17-23)27-26-21-12-10-20(11-13-21)25(29)30-2/h3,10-17H,1,4-9,18-19H2,2H3/b27-26+ |
| InChIKey | HHRHGMDYFOPKIA-CYYJNZCTSA-N |
| XLogP | 6.34 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|