C39H48N2O7 — CID 102573197
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate (PubChem CID 102573197) has the molecular formula C39H48N2O7 and a molecular weight of 656.82 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 102573197 |
| Molecular Formula | C39H48N2O7 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[[4-(8-prop-2-enoyloxyoctoxy)phenyl]diazenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(/N=N/c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H48N2O7/c1-4-6-7-12-15-30(3)47-38(43)32-18-24-36(25-19-32)48-39(44)31-16-20-33(21-17-31)40-41-34-22-26-35(27-23-34)45-28-13-10-8-9-11-14-29-46-37(42)5-2/h5,16-27,30H,2,4,6-15,28-29H2,1,3H3/b41-40+/t30-/m0/s1 |
| InChIKey | FOFWSTCHWXLBPE-YPZNKOGSSA-N |
| XLogP | 10.29 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|