C38H46O5 — CID 102437397
(4-octoxyphenyl) 4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]benzoate (PubChem CID 102437397) has the molecular formula C38H46O5 and a molecular weight of 582.78 g/mol. Its IUPAC name is (4-octoxyphenyl) 4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]benzoate.
| Compound Name | (4-octoxyphenyl) 4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 102437397 |
| Molecular Formula | C38H46O5 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | (4-octoxyphenyl) 4-[2-[4-[(2R)-octan-2-yl]oxycarbonylphenyl]ethynyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(C#Cc3ccc(C(=O)O[C@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H46O5/c1-4-6-8-10-11-13-29-41-35-25-27-36(28-26-35)43-38(40)34-23-19-32(20-24-34)16-15-31-17-21-33(22-18-31)37(39)42-30(3)14-12-9-7-5-2/h17-28,30H,4-14,29H2,1-3H3/t30-/m1/s1 |
| InChIKey | WTURNLXZUQCBBY-SSEXGKCCSA-N |
| XLogP | 9.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|