C35H44N2O5 — CID 139745345
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[(4-heptoxyphenyl)diazenyl]benzoate (PubChem CID 139745345) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[(4-heptoxyphenyl)diazenyl]benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[(4-heptoxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 139745345 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[(4-heptoxyphenyl)diazenyl]benzoate |
| SMILES | CCCCCCCOc1ccc(/N=N/c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H44N2O5/c1-4-6-8-10-12-26-40-32-24-20-31(21-25-32)37-36-30-18-14-28(15-19-30)35(39)42-33-22-16-29(17-23-33)34(38)41-27(3)13-11-9-7-5-2/h14-25,27H,4-13,26H2,1-3H3/b37-36+/t27-/m0/s1 |
| InChIKey | ACBDFLCFFGJXRY-MTAUIMSBSA-N |
| XLogP | 10.19 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|