C34H42O5 — CID 102103966
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(4-hexoxyphenyl)benzoate (PubChem CID 102103966) has the molecular formula C34H42O5 and a molecular weight of 530.71 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(4-hexoxyphenyl)benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(4-hexoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102103966 |
| Molecular Formula | C34H42O5 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-(4-hexoxyphenyl)benzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H42O5/c1-4-6-8-10-12-26(3)38-33(35)30-19-23-32(24-20-30)39-34(36)29-15-13-27(14-16-29)28-17-21-31(22-18-28)37-25-11-9-7-5-2/h13-24,26H,4-12,25H2,1-3H3/t26-/m0/s1 |
| InChIKey | FBZZZNZSUPFXRD-SANMLTNESA-N |
| XLogP | 9.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|