C40H48O5 — CID 101172480
[(2R)-octan-2-yl] 6-[4-(4-octoxyphenyl)benzoyl]oxynaphthalene-2-carboxylate (PubChem CID 101172480) has the molecular formula C40H48O5 and a molecular weight of 608.82 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 6-[4-(4-octoxyphenyl)benzoyl]oxynaphthalene-2-carboxylate.
| Compound Name | [(2R)-octan-2-yl] 6-[4-(4-octoxyphenyl)benzoyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 101172480 |
| Molecular Formula | C40H48O5 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | [(2R)-octan-2-yl] 6-[4-(4-octoxyphenyl)benzoyl]oxynaphthalene-2-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc4cc(C(=O)O[C@H](C)CCCCCC)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C40H48O5/c1-4-6-8-10-11-13-27-43-37-24-21-32(22-25-37)31-15-17-33(18-16-31)39(41)45-38-26-23-34-28-36(20-19-35(34)29-38)40(42)44-30(3)14-12-9-7-5-2/h15-26,28-30H,4-14,27H2,1-3H3/t30-/m1/s1 |
| InChIKey | GBVISIJBZSBTBF-SSEXGKCCSA-N |
| XLogP | 10.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|