C37H47FO5 — CID 54456207
[(2R)-5-methylhexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-2-fluorobenzoate (PubChem CID 54456207) has the molecular formula C37H47FO5 and a molecular weight of 590.78 g/mol. Its IUPAC name is [(2R)-5-methylhexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-2-fluorobenzoate.
| Compound Name | [(2R)-5-methylhexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 54456207 |
| Molecular Formula | C37H47FO5 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | [(2R)-5-methylhexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-2-fluorobenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@H](C)CCC(C)C)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C37H47FO5/c1-5-6-7-8-9-10-11-12-25-41-32-21-19-30(20-22-32)29-15-17-31(18-16-29)36(39)43-33-23-24-34(35(38)26-33)37(40)42-28(4)14-13-27(2)3/h15-24,26-28H,5-14,25H2,1-4H3/t28-/m1/s1 |
| InChIKey | WYJAOJBMVKBYQS-MUUNZHRXSA-N |
| XLogP | 10.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|