C36H42F4O5 — CID 19598543
(1,1,1-trifluoro-5-methylhexan-2-yl) 2-fluoro-4-[4-(4-nonoxyphenyl)benzoyl]oxybenzoate (PubChem CID 19598543) has the molecular formula C36H42F4O5 and a molecular weight of 630.72 g/mol. Its IUPAC name is (1,1,1-trifluoro-5-methylhexan-2-yl) 2-fluoro-4-[4-(4-nonoxyphenyl)benzoyl]oxybenzoate.
| Compound Name | (1,1,1-trifluoro-5-methylhexan-2-yl) 2-fluoro-4-[4-(4-nonoxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 19598543 |
| Molecular Formula | C36H42F4O5 |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (1,1,1-trifluoro-5-methylhexan-2-yl) 2-fluoro-4-[4-(4-nonoxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCC(C)C)C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C36H42F4O5/c1-4-5-6-7-8-9-10-23-43-29-18-16-27(17-19-29)26-12-14-28(15-13-26)34(41)44-30-20-21-31(32(37)24-30)35(42)45-33(36(38,39)40)22-11-25(2)3/h12-21,24-25,33H,4-11,22-23H2,1-3H3 |
| InChIKey | SQHCSLKZCWERDE-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|