C37H44F4O6 — CID 18690708
(7-ethoxy-1,1,1-trifluoroheptan-2-yl) 2-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate (PubChem CID 18690708) has the molecular formula C37H44F4O6 and a molecular weight of 660.75 g/mol. Its IUPAC name is (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 2-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate.
| Compound Name | (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 2-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 18690708 |
| Molecular Formula | C37H44F4O6 |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 2-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCCCCOCC)C(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C37H44F4O6/c1-3-5-6-7-8-12-25-45-30-20-18-28(19-21-30)27-14-16-29(17-15-27)35(42)46-31-22-23-32(33(38)26-31)36(43)47-34(37(39,40)41)13-10-9-11-24-44-4-2/h14-23,26,34H,3-13,24-25H2,1-2H3 |
| InChIKey | YNVNYOIELSQFJT-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|