C38H47F3O5 — CID 70281991
[(2R)-1,1,1-trifluorooctan-2-yl] 3-[4-(4-decoxyphenyl)benzoyl]oxybenzoate (PubChem CID 70281991) has the molecular formula C38H47F3O5 and a molecular weight of 640.78 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 3-[4-(4-decoxyphenyl)benzoyl]oxybenzoate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 3-[4-(4-decoxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 70281991 |
| Molecular Formula | C38H47F3O5 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 3-[4-(4-decoxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3cccc(C(=O)O[C@H](CCCCCC)C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C38H47F3O5/c1-3-5-7-9-10-11-12-14-27-44-33-25-23-30(24-26-33)29-19-21-31(22-20-29)36(42)45-34-17-15-16-32(28-34)37(43)46-35(38(39,40)41)18-13-8-6-4-2/h15-17,19-26,28,35H,3-14,18,27H2,1-2H3/t35-/m1/s1 |
| InChIKey | XVMPHBACIWFONW-PGUFJCEWSA-N |
| XLogP | 11.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|