C33H37F3O5 — CID 139601703
[(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-hexoxyphenyl)benzoyl]oxy-3-methylbenzoate (PubChem CID 139601703) has the molecular formula C33H37F3O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-hexoxyphenyl)benzoyl]oxy-3-methylbenzoate.
| Compound Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-hexoxyphenyl)benzoyl]oxy-3-methylbenzoate |
|---|---|
| PubChem CID | 139601703 |
| Molecular Formula | C33H37F3O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-hexoxyphenyl)benzoyl]oxy-3-methylbenzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](CCCC)C(F)(F)F)cc3C)cc2)cc1 |
| InChI | InChI=1S/C33H37F3O5/c1-4-6-8-9-21-39-28-18-15-25(16-19-28)24-11-13-26(14-12-24)31(37)40-29-20-17-27(22-23(29)3)32(38)41-30(10-7-5-2)33(34,35)36/h11-20,22,30H,4-10,21H2,1-3H3/t30-/m0/s1 |
| InChIKey | PMIFOMRSUPSFMH-PMERELPUSA-N |
| XLogP | 9.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|