C35H43FO5 — CID 101068146
heptan-4-yl 3-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate (PubChem CID 101068146) has the molecular formula C35H43FO5 and a molecular weight of 562.72 g/mol. Its IUPAC name is heptan-4-yl 3-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate.
| Compound Name | heptan-4-yl 3-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 101068146 |
| Molecular Formula | C35H43FO5 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | heptan-4-yl 3-fluoro-4-[4-(4-octoxyphenyl)benzoyl]oxybenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCC)CCC)cc3F)cc2)cc1 |
| InChI | InChI=1S/C35H43FO5/c1-4-7-8-9-10-11-24-39-30-21-18-27(19-22-30)26-14-16-28(17-15-26)34(37)41-33-23-20-29(25-32(33)36)35(38)40-31(12-5-2)13-6-3/h14-23,25,31H,4-13,24H2,1-3H3 |
| InChIKey | ZROYJYNSLWPJCK-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|