C37H45F3O5 — CID 139601710
[(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-3-methylbenzoate (PubChem CID 139601710) has the molecular formula C37H45F3O5 and a molecular weight of 626.76 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-3-methylbenzoate.
| Compound Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-3-methylbenzoate |
|---|---|
| PubChem CID | 139601710 |
| Molecular Formula | C37H45F3O5 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | [(2S)-1,1,1-trifluorohexan-2-yl] 4-[4-(4-decoxyphenyl)benzoyl]oxy-3-methylbenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)O[C@@H](CCCC)C(F)(F)F)cc3C)cc2)cc1 |
| InChI | InChI=1S/C37H45F3O5/c1-4-6-8-9-10-11-12-13-25-43-32-22-19-29(20-23-32)28-15-17-30(18-16-28)35(41)44-33-24-21-31(26-27(33)3)36(42)45-34(14-7-5-2)37(38,39)40/h15-24,26,34H,4-14,25H2,1-3H3/t34-/m0/s1 |
| InChIKey | IJVJKHYQTNYMDM-UMSFTDKQSA-N |
| XLogP | 10.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|