C37H47F3O3 — CID 139607785
1,1,1-trifluorodecan-2-yl 4-[2-(4-octoxyphenyl)phenyl]benzoate (PubChem CID 139607785) has the molecular formula C37H47F3O3 and a molecular weight of 596.77 g/mol. Its IUPAC name is 1,1,1-trifluorodecan-2-yl 4-[2-(4-octoxyphenyl)phenyl]benzoate.
| Compound Name | 1,1,1-trifluorodecan-2-yl 4-[2-(4-octoxyphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 139607785 |
| Molecular Formula | C37H47F3O3 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | 1,1,1-trifluorodecan-2-yl 4-[2-(4-octoxyphenyl)phenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccccc2-c2ccc(C(=O)OC(CCCCCCCC)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H47F3O3/c1-3-5-7-9-11-13-19-35(37(38,39)40)43-36(41)31-22-20-29(21-23-31)33-17-14-15-18-34(33)30-24-26-32(27-25-30)42-28-16-12-10-8-6-4-2/h14-15,17-18,20-27,35H,3-13,16,19,28H2,1-2H3 |
| InChIKey | XTSCPSLFTVCSHK-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|