C35H41F5O3 — CID 22079632
1,1,1-trifluorooctan-2-yl 4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]benzoate (PubChem CID 22079632) has the molecular formula C35H41F5O3 and a molecular weight of 604.70 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]benzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 22079632 |
| Molecular Formula | C35H41F5O3 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C35H41F5O3/c1-3-5-7-9-10-12-24-42-30-23-22-29(32(36)33(30)37)27-18-14-25(15-19-27)26-16-20-28(21-17-26)34(41)43-31(35(38,39)40)13-11-8-6-4-2/h14-23,31H,3-13,24H2,1-2H3 |
| InChIKey | JIBCMZFZIFDDOM-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|