C26H31F5O4 — CID 88597293
[2,3-difluoro-4-(4-hexoxyphenyl)phenyl] 1,1,1-trifluoroheptan-2-yl carbonate (PubChem CID 88597293) has the molecular formula C26H31F5O4 and a molecular weight of 502.52 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-hexoxyphenyl)phenyl] 1,1,1-trifluoroheptan-2-yl carbonate.
| Compound Name | [2,3-difluoro-4-(4-hexoxyphenyl)phenyl] 1,1,1-trifluoroheptan-2-yl carbonate |
|---|---|
| PubChem CID | 88597293 |
| Molecular Formula | C26H31F5O4 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [2,3-difluoro-4-(4-hexoxyphenyl)phenyl] 1,1,1-trifluoroheptan-2-yl carbonate |
| SMILES | CCCCCCOc1ccc(-c2ccc(OC(=O)OC(CCCCC)C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H31F5O4/c1-3-5-7-9-17-33-19-13-11-18(12-14-19)20-15-16-21(24(28)23(20)27)34-25(32)35-22(26(29,30)31)10-8-6-4-2/h11-16,22H,3-10,17H2,1-2H3 |
| InChIKey | LMLWZLUFBKCWHO-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|