C33H34F2O2 — CID 19107879
1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(4-heptoxyphenyl)phenyl]benzene (PubChem CID 19107879) has the molecular formula C33H34F2O2 and a molecular weight of 500.63 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(4-heptoxyphenyl)phenyl]benzene.
| Compound Name | 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(4-heptoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 19107879 |
| Molecular Formula | C33H34F2O2 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,3-difluoro-4-[4-(4-heptoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(OCC)cc4)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C33H34F2O2/c1-3-5-6-7-8-23-37-29-17-13-25(14-18-29)24-9-11-26(12-10-24)30-21-22-31(33(35)32(30)34)27-15-19-28(20-16-27)36-4-2/h9-22H,3-8,23H2,1-2H3 |
| InChIKey | CJNHJQJXZOJBSV-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|