C34H36F2O2 — CID 19107947
2,3-difluoro-1-[4-(4-heptoxyphenyl)phenyl]-4-(4-propoxyphenyl)benzene (PubChem CID 19107947) has the molecular formula C34H36F2O2 and a molecular weight of 514.66 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(4-heptoxyphenyl)phenyl]-4-(4-propoxyphenyl)benzene.
| Compound Name | 2,3-difluoro-1-[4-(4-heptoxyphenyl)phenyl]-4-(4-propoxyphenyl)benzene |
|---|---|
| PubChem CID | 19107947 |
| Molecular Formula | C34H36F2O2 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2,3-difluoro-1-[4-(4-heptoxyphenyl)phenyl]-4-(4-propoxyphenyl)benzene |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(-c4ccc(OCCC)cc4)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H36F2O2/c1-3-5-6-7-8-24-38-30-17-13-26(14-18-30)25-9-11-27(12-10-25)31-21-22-32(34(36)33(31)35)28-15-19-29(20-16-28)37-23-4-2/h9-22H,3-8,23-24H2,1-2H3 |
| InChIKey | GPKDECGAWHBFOE-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|