C25H26F2O — CID 162480776
1-(4-ethylphenyl)-2,3-difluoro-4-(4-pentoxyphenyl)benzene (PubChem CID 162480776) has the molecular formula C25H26F2O and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2,3-difluoro-4-(4-pentoxyphenyl)benzene.
| Compound Name | 1-(4-ethylphenyl)-2,3-difluoro-4-(4-pentoxyphenyl)benzene |
|---|---|
| PubChem CID | 162480776 |
| Molecular Formula | C25H26F2O |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(4-ethylphenyl)-2,3-difluoro-4-(4-pentoxyphenyl)benzene |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(CC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H26F2O/c1-3-5-6-17-28-21-13-11-20(12-14-21)23-16-15-22(24(26)25(23)27)19-9-7-18(4-2)8-10-19/h7-16H,3-6,17H2,1-2H3 |
| InChIKey | SZVLCMGFQMQVNB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|