C28H32F2O2 — CID 59928905
2,3-difluoro-1-[4-(methoxymethyl)phenyl]-4-(4-octoxyphenyl)benzene (PubChem CID 59928905) has the molecular formula C28H32F2O2 and a molecular weight of 438.56 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(methoxymethyl)phenyl]-4-(4-octoxyphenyl)benzene.
| Compound Name | 2,3-difluoro-1-[4-(methoxymethyl)phenyl]-4-(4-octoxyphenyl)benzene |
|---|---|
| PubChem CID | 59928905 |
| Molecular Formula | C28H32F2O2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2,3-difluoro-1-[4-(methoxymethyl)phenyl]-4-(4-octoxyphenyl)benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(COC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H32F2O2/c1-3-4-5-6-7-8-19-32-24-15-13-23(14-16-24)26-18-17-25(27(29)28(26)30)22-11-9-21(10-12-22)20-31-2/h9-18H,3-8,19-20H2,1-2H3 |
| InChIKey | WHNIPAGNBYQBFX-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|