C19H19F2NO — CID 14548499
2,3-difluoro-4-(4-hexoxyphenyl)benzonitrile (PubChem CID 14548499) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is 2,3-difluoro-4-(4-hexoxyphenyl)benzonitrile.
| Compound Name | 2,3-difluoro-4-(4-hexoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 14548499 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2,3-difluoro-4-(4-hexoxyphenyl)benzonitrile |
| SMILES | CCCCCCOc1ccc(-c2ccc(C#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H19F2NO/c1-2-3-4-5-12-23-16-9-6-14(7-10-16)17-11-8-15(13-22)18(20)19(17)21/h6-11H,2-5,12H2,1H3 |
| InChIKey | WXEGMQQIRGFUMV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|