C25H23F5O2 — CID 70388550
2,3-difluoro-1-(4-hexoxyphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 70388550) has the molecular formula C25H23F5O2 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-hexoxyphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 2,3-difluoro-1-(4-hexoxyphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 70388550 |
| Molecular Formula | C25H23F5O2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2,3-difluoro-1-(4-hexoxyphenyl)-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(OC(F)(F)F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H23F5O2/c1-2-3-4-5-16-31-19-10-6-17(7-11-19)21-14-15-22(24(27)23(21)26)18-8-12-20(13-9-18)32-25(28,29)30/h6-15H,2-5,16H2,1H3 |
| InChIKey | FRBZKCBICHTIQF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|