C24H22F4O2 — CID 67797398
2-fluoro-4-pentoxy-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]benzene (PubChem CID 67797398) has the molecular formula C24H22F4O2 and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-fluoro-4-pentoxy-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]benzene.
| Compound Name | 2-fluoro-4-pentoxy-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 67797398 |
| Molecular Formula | C24H22F4O2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-fluoro-4-pentoxy-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]benzene |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C24H22F4O2/c1-2-3-4-15-29-21-13-14-22(23(25)16-21)19-7-5-17(6-8-19)18-9-11-20(12-10-18)30-24(26,27)28/h5-14,16H,2-4,15H2,1H3 |
| InChIKey | CPCQIUACQLCSQN-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|