C25H25F3O2 — CID 54231348
4-(difluoromethoxy)-2-fluoro-1-[4-(4-hexoxyphenyl)phenyl]benzene (PubChem CID 54231348) has the molecular formula C25H25F3O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-fluoro-1-[4-(4-hexoxyphenyl)phenyl]benzene.
| Compound Name | 4-(difluoromethoxy)-2-fluoro-1-[4-(4-hexoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 54231348 |
| Molecular Formula | C25H25F3O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(difluoromethoxy)-2-fluoro-1-[4-(4-hexoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(OC(F)F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C25H25F3O2/c1-2-3-4-5-16-29-21-12-10-19(11-13-21)18-6-8-20(9-7-18)23-15-14-22(17-24(23)26)30-25(27)28/h6-15,17,25H,2-5,16H2,1H3 |
| InChIKey | QJMCCKNBADXOKD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|