C18H18F4O2 — CID 19436415
1-[4-(difluoromethoxy)phenyl]-2,3-difluoro-4-pentoxybenzene (PubChem CID 19436415) has the molecular formula C18H18F4O2 and a molecular weight of 342.33 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2,3-difluoro-4-pentoxybenzene.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2,3-difluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 19436415 |
| Molecular Formula | C18H18F4O2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2,3-difluoro-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(-c2ccc(OC(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C18H18F4O2/c1-2-3-4-11-23-15-10-9-14(16(19)17(15)20)12-5-7-13(8-6-12)24-18(21)22/h5-10,18H,2-4,11H2,1H3 |
| InChIKey | MZNFAJFQKJTZLZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|