C21H24F4O2 — CID 125478760
1-(2,3-difluoro-4-hexoxyphenyl)-2,3-difluoro-4-propoxybenzene (PubChem CID 125478760) has the molecular formula C21H24F4O2 and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-hexoxyphenyl)-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-(2,3-difluoro-4-hexoxyphenyl)-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 125478760 |
| Molecular Formula | C21H24F4O2 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(2,3-difluoro-4-hexoxyphenyl)-2,3-difluoro-4-propoxybenzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(OCCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H24F4O2/c1-3-5-6-7-13-27-17-11-9-15(19(23)21(17)25)14-8-10-16(26-12-4-2)20(24)18(14)22/h8-11H,3-7,12-13H2,1-2H3 |
| InChIKey | CKQBZQKTZOOYPC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|