C20H22ClF3O2 — CID 125478968
1-(2-chloro-4-ethoxy-3-fluorophenyl)-2,3-difluoro-4-hexoxybenzene (PubChem CID 125478968) has the molecular formula C20H22ClF3O2 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-(2-chloro-4-ethoxy-3-fluorophenyl)-2,3-difluoro-4-hexoxybenzene.
| Compound Name | 1-(2-chloro-4-ethoxy-3-fluorophenyl)-2,3-difluoro-4-hexoxybenzene |
|---|---|
| PubChem CID | 125478968 |
| Molecular Formula | C20H22ClF3O2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-(2-chloro-4-ethoxy-3-fluorophenyl)-2,3-difluoro-4-hexoxybenzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(OCC)c(F)c2Cl)c(F)c1F |
| InChI | InChI=1S/C20H22ClF3O2/c1-3-5-6-7-12-26-16-11-9-14(18(22)20(16)24)13-8-10-15(25-4-2)19(23)17(13)21/h8-11H,3-7,12H2,1-2H3 |
| InChIKey | KJBABVLWNSMQJL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|