C14H19F3O2 — CID 153282559
1-butoxy-2,3-difluoro-4-(4-fluorobutoxy)benzene (PubChem CID 153282559) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-butoxy-2,3-difluoro-4-(4-fluorobutoxy)benzene.
| Compound Name | 1-butoxy-2,3-difluoro-4-(4-fluorobutoxy)benzene |
|---|---|
| PubChem CID | 153282559 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-butoxy-2,3-difluoro-4-(4-fluorobutoxy)benzene |
| SMILES | CCCCOc1ccc(OCCCCF)c(F)c1F |
| InChI | InChI=1S/C14H19F3O2/c1-2-3-9-18-11-6-7-12(14(17)13(11)16)19-10-5-4-8-15/h6-7H,2-5,8-10H2,1H3 |
| InChIKey | XKLBEQHOBYNNTO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|