C15H22F2O2 — CID 170380825
1-butoxy-2,3-difluoro-4-(3-methylbutoxy)benzene (PubChem CID 170380825) has the molecular formula C15H22F2O2 and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-butoxy-2,3-difluoro-4-(3-methylbutoxy)benzene.
| Compound Name | 1-butoxy-2,3-difluoro-4-(3-methylbutoxy)benzene |
|---|---|
| PubChem CID | 170380825 |
| Molecular Formula | C15H22F2O2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-butoxy-2,3-difluoro-4-(3-methylbutoxy)benzene |
| SMILES | CCCCOc1ccc(OCCC(C)C)c(F)c1F |
| InChI | InChI=1S/C15H22F2O2/c1-4-5-9-18-12-6-7-13(15(17)14(12)16)19-10-8-11(2)3/h6-7,11H,4-5,8-10H2,1-3H3 |
| InChIKey | ATRUZRXIPGVJDZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|