C16H23F3O2 — CID 153282577
2,3-difluoro-1-(3-fluorobutoxy)-4-(3-methylpentoxy)benzene (PubChem CID 153282577) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2,3-difluoro-1-(3-fluorobutoxy)-4-(3-methylpentoxy)benzene.
| Compound Name | 2,3-difluoro-1-(3-fluorobutoxy)-4-(3-methylpentoxy)benzene |
|---|---|
| PubChem CID | 153282577 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2,3-difluoro-1-(3-fluorobutoxy)-4-(3-methylpentoxy)benzene |
| SMILES | CCC(C)CCOc1ccc(OCCC(C)F)c(F)c1F |
| InChI | InChI=1S/C16H23F3O2/c1-4-11(2)7-9-20-13-5-6-14(16(19)15(13)18)21-10-8-12(3)17/h5-6,11-12H,4,7-10H2,1-3H3 |
| InChIKey | SBQSRXVSIVQUFC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |